Safe Delivery to Mexico/Canada  Propanoyl chloride CAS 79-03-8 

Chinese name: Propionyl chloride

Chinese alias: Propionyl chloride

English name: propionyl chloride

CAS Number: 79-03-8

EINECS Number: 201-170-0

Molecular formula: C3H5OCl

Molecular weight: 92.5242

InChI: InChI=1/C3H5ClO/c1-2-3(4)5/h2H2,1H3

Molecular structure: Propionyl chloride 79-03-8

Density: 1.068g/cm3

Melting point: -94℃

Boiling point: 75.5°C at 760 mmHg

Flash point: 11.7°C

Water Soluble: REACTS

Vapor Pressure: 105mmHg at 25°C

Content: 99%

Properties: Colorless liquid with pungent odor

Boiling point 80℃

Freezing point -94℃

Relative density 1.065

Refractive index 1.4032

Flash point 12℃

Solubility in ethanol

Product use: In the pharmaceutical industry, it is used in the production of the antiepileptic drug mettoin, the antiadrenergic drug methoxyamine hydrochloride, and used as a propionyl reagent in organic synthesis